EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H14CuN8O6S2 |
| Net Charge | -2 |
| Average Mass | 734.194 |
| Monoisotopic Mass | 732.97847 |
| SMILES | O=S(=O)([O-])c1cccc2c1C1=Nc3c4ccccc4c4[n]3[Cu-2]35[n]6c(c7ccccc7c6=NC6=[N+]3C(=N4)c3cccc(S(=O)(=O)[O-])c36)=NC2=[N+]15 |
| InChI | InChI=1S/C32H16N8O6S2.Cu/c41-47(42,43)21-13-5-11-19-23(21)32-38-28-18-10-4-2-8-16(18)26(34-28)36-30-20-12-6-14-22(48(44,45)46)24(20)31(40-30)37-27-17-9-3-1-7-15(17)25(33-27)35-29(19)39-32;/h1-14H,(H2-2,33,34,35,36,37,38,39,40,41,42,43,44,45,46);/q-2;+2/p-2 |
| InChIKey | WPFRZRORZCBVMI-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luxol fast blue MBS(2−) (CHEBI:90214) is a organosulfonate oxoanion (CHEBI:33554) |
| Luxol fast blue MBS(2−) (CHEBI:90214) is conjugate base of Luxol fast blue MBS (acid form) (CHEBI:90215) |
| Incoming Relation(s) |
| Luxol fast blue MBS (CHEBI:90211) has part Luxol fast blue MBS(2−) (CHEBI:90214) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) is conjugate acid of Luxol fast blue MBS(2−) (CHEBI:90214) |
| IUPAC Name |
|---|
| [29H,31H-phthalocyanine-8,22-disulfonato(4−)-κ4N29,N30,N31,N32]cuprate(2−) |
| Synonym | Source |
|---|---|
| Luxol fast blue MBS dianion | ChEBI |