EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H16CuN8O6S2 |
| Net Charge | 0 |
| Average Mass | 736.210 |
| Monoisotopic Mass | 734.99302 |
| SMILES | O=S(=O)(O)c1cccc2c1C1=Nc3c4ccccc4c4[n]3[Cu-2]35[n]6c(c7ccccc7c6=NC6=[N+]3C(=N4)c3cccc(S(=O)(=O)O)c36)=NC2=[N+]15 |
| InChI | InChI=1S/C32H16N8O6S2.Cu/c41-47(42,43)21-13-5-11-19-23(21)32-38-28-18-10-4-2-8-16(18)26(34-28)36-30-20-12-6-14-22(48(44,45)46)24(20)31(40-30)37-27-17-9-3-1-7-15(17)25(33-27)35-29(19)39-32;/h1-14H,(H2-2,33,34,35,36,37,38,39,40,41,42,43,44,45,46);/q-2;+2 |
| InChIKey | WPFRZRORZCBVMI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) has role fluorochrome (CHEBI:51217) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) has role histological dye (CHEBI:77178) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) is a arenesulfonic acid (CHEBI:33555) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) is a copper coordination entity (CHEBI:37403) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) is a metallophthalocyanines (CHEBI:51584) |
| Luxol fast blue MBS (acid form) (CHEBI:90215) is conjugate acid of Luxol fast blue MBS(2−) (CHEBI:90214) |
| Incoming Relation(s) |
| Luxol fast blue MBS(2−) (CHEBI:90214) is conjugate base of Luxol fast blue MBS (acid form) (CHEBI:90215) |
| IUPAC Name |
|---|
| [29H,31H-phthalocyanine-8,22-disulfonato(2−)-κ4N29,N30,N31,N32]copper |
| Synonym | Source |
|---|---|
| Luxol fast blue MBS free acid | ChEBI |