EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C15H18N3.C32H14CuN8O6S2 |
| Net Charge | 0 |
| Average Mass | 1214.854 |
| Monoisotopic Mass | 1213.27751 |
| SMILES | Cc1ccccc1NC(=[NH2+])Nc1ccccc1C.Cc1ccccc1NC(=[NH2+])Nc1ccccc1C.O=S(=O)([O-])c1cccc2c1C1=Nc3c4ccccc4c4[n]3[Cu-2]35[n]6c(c7ccccc7c6=NC6=[N+]3C(=N4)c3cccc(S(=O)(=O)[O-])c36)=NC2=[N+]15 |
| InChI | InChI=1S/C32H16N8O6S2.2C15H17N3.Cu/c41-47(42,43)21-13-5-11-19-23(21)32-38-28-18-10-4-2-8-16(18)26(34-28)36-30-20-12-6-14-22(48(44,45)46)24(20)31(40-30)37-27-17-9-3-1-7-15(17)25(33-27)35-29(19)39-32;2*1-11-7-3-5-9-13(11)17-15(16)18-14-10-6-4-8-12(14)2;/h1-14H,(H2-2,33,34,35,36,37,38,39,40,41,42,43,44,45,46);2*3-10H,1-2H3,(H3,16,17,18);/q-2;;;+2 |
| InChIKey | LUWJPTVQOMUZLW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Luxol fast blue MBS (CHEBI:90211) has part Luxol fast blue MBS(2−) (CHEBI:90214) |
| Luxol fast blue MBS (CHEBI:90211) has role fluorochrome (CHEBI:51217) |
| Luxol fast blue MBS (CHEBI:90211) has role histological dye (CHEBI:77178) |
| Luxol fast blue MBS (CHEBI:90211) is a guanidinium salt (CHEBI:83635) |
| Luxol fast blue MBS (CHEBI:90211) is a organosulfonate salt (CHEBI:64382) |
| IUPAC Name |
|---|
| bis[bis(2-methylanilino)methaniminium] [29H,31H-phthalocyanine-8,22-disulfonato(4−)-κ4N29,N30,N31,N32]cuprate(2−) |
| Synonyms | Source |
|---|---|
| C.I. 74180 | ChEBI |
| Luxol fast blue | ChEBI |
| solvent blue 38 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Luxol_fast_blue_stain | Wikipedia |