EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10Cl2N4O7S2 |
| Net Charge | -2 |
| Average Mass | 505.317 |
| Monoisotopic Mass | 503.93789 |
| SMILES | Cc1nn(-c2cc(Cl)c(S(=O)(=O)[O-])cc2Cl)c(O)c1N=Nc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C16H12Cl2N4O7S2/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29/h2-7,23H,1H3,(H,24,25,26)(H,27,28,29)/p-2 |
| InChIKey | SWTAMHBAAIVEKW-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine fast yellow(2−) (CHEBI:90208) is a organosulfonate oxoanion (CHEBI:33554) |
| lissamine fast yellow(2−) (CHEBI:90208) is conjugate base of lissamine fast yellow (acid form) (CHEBI:90210) |
| Incoming Relation(s) |
| lissamine fast yellow (CHEBI:90206) has part lissamine fast yellow(2−) (CHEBI:90208) |
| lissamine fast yellow (acid form) (CHEBI:90210) is conjugate acid of lissamine fast yellow(2−) (CHEBI:90208) |
| IUPAC Name |
|---|
| 2,5-dichloro-4-{5-hydroxy-3-methyl-4-[(4-sulfonatophenyl)diazenyl]-1H-pyrazol-1-yl}benzene-1-sulfonate |
| Synonym | Source |
|---|---|
| lissamine fast yellow dianion | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8171654 | Reaxys |