EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10Cl2N4O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 551.297 |
| Monoisotopic Mass | 549.91633 |
| SMILES | Cc1nn(-c2cc(Cl)c(S(=O)(=O)[O-])cc2Cl)c(O)c1N=Nc1ccc(S(=O)(=O)[O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C16H12Cl2N4O7S2.2Na/c1-8-15(20-19-9-2-4-10(5-3-9)30(24,25)26)16(23)22(21-8)13-6-12(18)14(7-11(13)17)31(27,28)29;;/h2-7,23H,1H3,(H,24,25,26)(H,27,28,29);;/q;2*+1/p-2 |
| InChIKey | QWSQBPVXJFWXDW-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). allergen A chemical compound, or part thereof, which causes the onset of an allergic reaction by interacting with any of the molecular pathways involved in an allergy. |
| Applications: | food colouring A food additive that imparts colour to food. In European countries, E-numbers for permitted food colours are from E 100 to E 199, divided into yellows (E 100-109), oranges (E 110-119), reds (E 120-129), blues and violets (E 130-139), greens (E 140-149), browns and blacks (E 150-159), and others (E 160-199). histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lissamine fast yellow (CHEBI:90206) has part lissamine fast yellow(2−) (CHEBI:90208) |
| lissamine fast yellow (CHEBI:90206) has role allergen (CHEBI:50904) |
| lissamine fast yellow (CHEBI:90206) has role food colouring (CHEBI:77182) |
| lissamine fast yellow (CHEBI:90206) has role histological dye (CHEBI:77178) |
| lissamine fast yellow (CHEBI:90206) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 2,5-dichloro-4-{5-hydroxy-3-methyl-4-[(4-sulfonatophenyl)diazenyl]-1H-pyrazol-1-yl}benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| C.I. 18965 | ChEBI |
| C.I. Acid Yellow 17 | ChemIDplus |
| C.I. Acid Yellow 17, disodium salt | ChemIDplus |
| C.I. Food Yellow 5 | ChemIDplus |
| Disodium 2,5-dichloro-4-(5-hydroxy-3-methyl-4-(sulphophenylazo)pyrazol-1-yl)benzenesulphonate | ChemIDplus |
| E 107 | ChEBI |
| Citations |
|---|