EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H28NO4S |
| Net Charge | +1 |
| Average Mass | 474.602 |
| Monoisotopic Mass | 474.17336 |
| SMILES | O=C(c1ccc(OCC[NH+]2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C28H27NO4S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2/p+1 |
| InChIKey | GZUITABIAKMVPG-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raloxifene(1+) (CHEBI:90191) is a ammonium ion derivative (CHEBI:35274) |
| raloxifene(1+) (CHEBI:90191) is conjugate acid of raloxifene (CHEBI:8772) |
| Incoming Relation(s) |
| raloxifene hydrochloride (CHEBI:50740) has part raloxifene(1+) (CHEBI:90191) |
| raloxifene (CHEBI:8772) is conjugate base of raloxifene(1+) (CHEBI:90191) |
| IUPAC Name |
|---|
| 1-[2-(4-{[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]carbonyl}phenoxy)ethyl]piperidinium |