EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27NO4S.HCl |
| Net Charge | 0 |
| Average Mass | 510.055 |
| Monoisotopic Mass | 509.14276 |
| SMILES | Cl.O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C28H27NO4S.ClH/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29;/h4-13,18,30-31H,1-3,14-17H2;1H |
| InChIKey | BKXVVCILCIUCLG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. estrogen receptor modulator A substance that possess antiestrogenic actions but can also produce estrogenic effects as well. It acts as complete or partial agonist or as antagonist. It can be either steroidal or nonsteroidal in structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raloxifene hydrochloride (CHEBI:50740) has part raloxifene(1+) (CHEBI:90191) |
| raloxifene hydrochloride (CHEBI:50740) has role bone density conservation agent (CHEBI:50646) |
| raloxifene hydrochloride (CHEBI:50740) has role estrogen antagonist (CHEBI:50837) |
| raloxifene hydrochloride (CHEBI:50740) has role estrogen receptor modulator (CHEBI:50739) |
| raloxifene hydrochloride (CHEBI:50740) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothien-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone hydrochloride |
| 1-[2-(4-{[6-hydroxy-2-(4-hydroxyphenyl)-1-benzothiophen-3-yl]carbonyl}phenoxy)ethyl]piperidinium chloride |
| Synonym | Source |
|---|---|
| 6-Hydroxy-2-(p-hydroxyphenyl)benzo(b)thien-3-yl-p-(2-piperidinoethoxy)phenyl ketone, hydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Evista | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6036780 | Reaxys |
| CAS:82640-04-8 | ChemIDplus |
| Citations |
|---|