EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H27NO4S |
| Net Charge | 0 |
| Average Mass | 473.594 |
| Monoisotopic Mass | 473.16608 |
| SMILES | O=C(c1ccc(OCCN2CCCCC2)cc1)c1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C28H27NO4S/c30-21-8-4-20(5-9-21)28-26(24-13-10-22(31)18-25(24)34-28)27(32)19-6-11-23(12-7-19)33-17-16-29-14-2-1-3-15-29/h4-13,18,30-31H,1-3,14-17H2 |
| InChIKey | GZUITABIAKMVPG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. |
| Applications: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. estrogen antagonist A compound which inhibits or antagonises the biosynthesis or actions of estrogens. estrogen receptor modulator A substance that possess antiestrogenic actions but can also produce estrogenic effects as well. It acts as complete or partial agonist or as antagonist. It can be either steroidal or nonsteroidal in structure. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| raloxifene (CHEBI:8772) has role bone density conservation agent (CHEBI:50646) |
| raloxifene (CHEBI:8772) has role estrogen antagonist (CHEBI:50837) |
| raloxifene (CHEBI:8772) has role estrogen receptor modulator (CHEBI:50739) |
| raloxifene (CHEBI:8772) is a N-oxyethylpiperidine (CHEBI:48737) |
| raloxifene (CHEBI:8772) is a 1-benzothiophenes (CHEBI:38836) |
| raloxifene (CHEBI:8772) is a aromatic ketone (CHEBI:76224) |
| raloxifene (CHEBI:8772) is a phenols (CHEBI:33853) |
| raloxifene (CHEBI:8772) is conjugate base of raloxifene(1+) (CHEBI:90191) |
| Incoming Relation(s) |
| raloxifene(1+) (CHEBI:90191) is conjugate acid of raloxifene (CHEBI:8772) |
| IUPAC Name |
|---|
| [6-hydroxy-2-(4-hydroxyphenyl)-1-benzothien-3-yl][4-(2-piperidin-1-ylethoxy)phenyl]methanone |
| INNs | Source |
|---|---|
| raloxifene | ChemIDplus |
| raloxifène | ChEBI |
| raloxifeno | ChemIDplus |
| raloxifenum | ChemIDplus |
| Synonyms | Source |
|---|---|
| (2-(4-Hydroxyphenyl)-6-hydroxybenzo(b)thien-3-yl)(4-(2-(1-piperidinyl)ethoxy)phenyl)methanone | ChemIDplus |
| LY 139481 | KEGG COMPOUND |
| Raloxifene | KEGG COMPOUND |
| Brand Name | Source |
|---|---|
| Keoxifene | DrugBank |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4890356 | Beilstein |
| CAS:84449-90-1 | ChemIDplus |