EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H38O8 |
| Net Charge | 0 |
| Average Mass | 466.571 |
| Monoisotopic Mass | 466.25667 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O[C@@H]5O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]5O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h12,14-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/t12-,14-,15-,16-,17-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | CLQMBSSRTBUNDV-CPKOJWPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (12560362) |
| Roles Classification |
|---|
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) has role human urinary metabolite (CHEBI:84087) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) is a 3-oxo-5α-steroid (CHEBI:13601) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) is a steroid glucosiduronic acid (CHEBI:26763) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) is conjugate acid of 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) |
| Incoming Relation(s) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is conjugate base of 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) |
| IUPAC Name |
|---|
| 3-oxo-5α-androstan-17β-yl β-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| 17β-hydroxy-5α-androstan-3-one glucuronide | ChEBI |
| 5alpha-Dihydrotestosterone glucuronide | HMDB |
| (5α,17β)-3-oxoandrostan-17-yl β-D-glucopyranosiduronic acid | IUPAC |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronic acid) | ChEBI |
| 5α-dihydrotestosterone-17G | ChEBI |
| 5α-dihydrotestosterone 17-β-glucuronide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0006203 | HMDB |
| LMST05010041 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6015621 | Reaxys |
| CAS:42037-24-1 | ChemIDplus |
| Citations |
|---|