EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30O2 |
| Net Charge | 0 |
| Average Mass | 290.447 |
| Monoisotopic Mass | 290.22458 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C19H30O2/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(21)19(15,2)10-8-16(14)18/h12,14-17,21H,3-11H2,1-2H3/t12-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | NVKAWKQGWWIWPM-ABEVXSGRSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Daphnia magna (ncbitaxon:35525) | - | Article (Changes in the Metabolic Elimination Profile of Testosterone Following Exposure of the Crustacean Daphnia magna to TributyltinGerald A. LeBlanc and James B. McLachlanEcotoxicology and Environmental Safety 45, 296-303 (2000)) | |
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. Daphnia magna metabolite A Daphnia metabolite produced by the species Daphnia magna. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) has parent hydride 5α-androstane (CHEBI:28859) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) has role Daphnia magna metabolite (CHEBI:83056) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) has role androgen (CHEBI:50113) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) has role human metabolite (CHEBI:77746) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) has role mouse metabolite (CHEBI:75771) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) is a 17β-hydroxy steroid (CHEBI:35343) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) is a 17β-hydroxyandrostan-3-one (CHEBI:85278) |
| 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) is a 3-oxo-5α-steroid (CHEBI:13601) |
| Incoming Relation(s) |
| 18-hydroxy-5α-dihydrotestosterone (CHEBI:137037) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 19-hydroxy-5α-dihydrotestosterone (CHEBI:137031) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 19-oxo-5α-dihydrotestosterone (CHEBI:137032) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 5α-dihydrotestosterone 17-O-[β-D-glucuronosyl-(1→2)-glucuronide] (CHEBI:137856) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| 5α-dihydrotestosterone sulfate (CHEBI:138026) has functional parent 17β-hydroxy-5α-androstan-3-one (CHEBI:16330) |
| IUPAC Name |
|---|
| 17β-hydroxy-5α-androstan-3-one |
| INNs | Source |
|---|---|
| androstanolona | ChemIDplus |
| androstanolone | ChemIDplus |
| androstanolone | WHO MedNet |
| androstanolonum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 17beta-hydroxy-5alpha-androstan-3-one | ChEBI |
| 17beta-Hydroxy-5alpha-androstan-3-one | KEGG COMPOUND |
| 17beta-hydroxyandrostan-3-one | ChEBI |
| 17beta-Hydroxyandrostan-3-one | KEGG COMPOUND |
| 17beta-Hydroxyandrostan-3-one | KEGG COMPOUND |
| 4,5α-dihydrotestosterone | ChEBI |
| UniProt Name | Source |
|---|---|
| 17β-hydroxy-5α-androstan-3-one | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 17-BETA-HYDROXY-5ALPHA-ANDROSTAN-3-O | MetaCyc |
| 3927 | DrugCentral |
| C03917 | KEGG COMPOUND |
| D07456 | KEGG DRUG |
| DB02901 | DrugBank |
| DHT | PDBeChem |
| Dihydrotestosterone | Wikipedia |
| HMDB0002961 | HMDB |
| LMST02020042 | LIPID MAPS |
| Citations |
|---|