EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H37O8 |
| Net Charge | -1 |
| Average Mass | 465.563 |
| Monoisotopic Mass | 465.24939 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](O[C@@H]5O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]5O)CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C25H38O8/c1-24-9-7-13(26)11-12(24)3-4-14-15-5-6-17(25(15,2)10-8-16(14)24)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h12,14-21,23,27-29H,3-11H2,1-2H3,(H,30,31)/p-1/t12-,14-,15-,16-,17-,18-,19-,20+,21-,23+,24-,25-/m0/s1 |
| InChIKey | CLQMBSSRTBUNDV-CPKOJWPQSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is a androstane conjugate (CHEBI:167106) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is a monocarboxylic acid anion (CHEBI:35757) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is a β-D-glucosiduronate (CHEBI:83411) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) is conjugate base of 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) |
| Incoming Relation(s) |
| 5α-dihydrotestosterone 17-O-(β-D-glucuronide) (CHEBI:89417) is conjugate acid of 5α-dihydrotestosterone 17-O-(β-D-glucuronide)(1−) (CHEBI:136914) |
| IUPAC Name |
|---|
| 3-oxo-5α-androstan-17β-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| (5α,17β)-3-oxoandrostan-17-yl β-D-glucopyranosiduronate | IUPAC |
| 5α-dihydrotestosterone-17G(1−) | SUBMITTER |
| 5α-dihydrotestosterone 17-glucuronide(1−) | ChEBI |
| 5α-dihydrotestosterone 17-β-glucuronide(1−) | ChEBI |
| 5α-dihydrotestosterone 17-(β-D-glucuronide)(1−) | ChEBI |
| UniProt Name | Source |
|---|---|
| 5α-dihydrotestosterone 17-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|