EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:16817 - trans-4-hydroxycyclohexanecarboxylic acid
| Formula | C7H12O3 |
| Net Charge | 0 |
| Average Mass | 144.170 |
| Monoisotopic Mass | 144.07864 |
| SMILES | O=C(O)[C@H]1CC[C@H](O)CC1 |
| InChI | InChI=1S/C7H12O3/c8-6-3-1-5(2-4-6)7(9)10/h5-6,8H,1-4H2,(H,9,10)/t5-,6- |
| InChIKey | HCFRWBBJISAZNK-IZLXSQMJSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) is a 4-hydroxycyclohexanecarboxylic acid (CHEBI:89341) |
| trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) is conjugate acid of trans-4-hydroxycyclohexanecarboxylate (CHEBI:57906) |
| Incoming Relation(s) |
| trans-4-hydroxycyclohexanecarboxylate (CHEBI:57906) is conjugate base of trans-4-hydroxycyclohexanecarboxylic acid (CHEBI:16817) |
| Synonym | Source |
|---|---|
| trans-4-hydroxycyclohexanecarboxylic acid | ChEBI |