EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48N6O5S2 |
| Net Charge | 0 |
| Average Mass | 720.962 |
| Monoisotopic Mass | 720.31276 |
| SMILES | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1 |
| InChI | InChI=1S/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46)/t28-,31-,32-,33-/m0/s1 |
| InChIKey | NCDNCNXCDXHOMX-XGKFQTDJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ritonavir (CHEBI:45409) has role antiviral drug (CHEBI:36044) |
| ritonavir (CHEBI:45409) has role environmental contaminant (CHEBI:78298) |
| ritonavir (CHEBI:45409) has role HIV protease inhibitor (CHEBI:35660) |
| ritonavir (CHEBI:45409) has role xenobiotic (CHEBI:35703) |
| ritonavir (CHEBI:45409) is a L-valine derivative (CHEBI:84129) |
| ritonavir (CHEBI:45409) is a 1,3-thiazoles (CHEBI:38418) |
| ritonavir (CHEBI:45409) is a carbamate ester (CHEBI:23003) |
| ritonavir (CHEBI:45409) is a carboxamide (CHEBI:37622) |
| ritonavir (CHEBI:45409) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| Kaletra (CHEBI:145924) has part ritonavir (CHEBI:45409) |
| Paxlovid (CHEBI:192712) has part ritonavir (CHEBI:45409) |
| Technivie (CHEBI:90919) has part ritonavir (CHEBI:45409) |
| Viekira Pak (CHEBI:85177) has part ritonavir (CHEBI:45409) |
| IUPAC Name |
|---|
| N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl]-N2-(methyl{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}carbamoyl)-L-valinamide |
| INN | Source |
|---|---|
| ritonavir | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:768009 | Reaxys |
| CAS:155213-67-5 | KEGG COMPOUND |
| CAS:155213-67-5 | ChemIDplus |
| Citations |
|---|