EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48N4O5.C37H48N6O5S2 |
| Net Charge | 0 |
| Average Mass | 1349.776 |
| Monoisotopic Mass | 1348.67523 |
| SMILES | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1.Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C37H48N6O5S2.C37H48N4O5/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30;1-25(2)34(41-20-12-19-38-37(41)45)36(44)39-30(21-28-15-7-5-8-16-28)23-32(42)31(22-29-17-9-6-10-18-29)40-33(43)24-46-35-26(3)13-11-14-27(35)4/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46);5-11,13-18,25,30-32,34,42H,12,19-24H2,1-4H3,(H,38,45)(H,39,44)(H,40,43)/t28-,31-,32-,33-;30-,31-,32-,34-/m00/s1 |
| InChIKey | OFFWOVJBSQMVPI-RMLGOCCBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kaletra (CHEBI:145924) has part lopinavir (CHEBI:31781) |
| Kaletra (CHEBI:145924) has part ritonavir (CHEBI:45409) |
| Kaletra (CHEBI:145924) has role anticoronaviral agent (CHEBI:149553) |
| Kaletra (CHEBI:145924) has role antiviral drug (CHEBI:36044) |
| Kaletra (CHEBI:145924) has role HIV protease inhibitor (CHEBI:35660) |
| Kaletra (CHEBI:145924) is a mixture (CHEBI:60004) |
| Synonyms | Source |
|---|---|
| lopinavir mixture with ritonavir | ChEBI |
| lopinavir/ritonavir | ChemIDplus |
| ritonavir and lopinavir mixture | ChemIDplus |
| lopinavir-ritonavir mixt | ChemIDplus |
| lopinavir & ritonavir | ChEBI |
| ABT-378 & ABT-538 | ChEBI |
| Brand Names | Source |
|---|---|
| Kaletra | ChemIDplus |
| Aluvia | ChemIDplus |
| Lopimune | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Lopinavir/ritonavir | Wikipedia |
| D02498 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:369372-47-4 | ChemIDplus |
| Citations |
|---|