EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48N4O5.C37H48N6O5S2 |
| Net Charge | 0 |
| Average Mass | 1349.776 |
| Monoisotopic Mass | 1348.67523 |
| SMILES | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1.Cc1cccc(C)c1OCC(=O)N[C@@H](Cc1ccccc1)[C@@H](O)C[C@H](Cc1ccccc1)NC(=O)[C@H](C(C)C)N1CCCNC1=O |
| InChI | InChI=1S/C37H48N6O5S2.C37H48N4O5/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30;1-25(2)34(41-20-12-19-38-37(41)45)36(44)39-30(21-28-15-7-5-8-16-28)23-32(42)31(22-29-17-9-6-10-18-29)40-33(43)24-46-35-26(3)13-11-14-27(35)4/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46);5-11,13-18,25,30-32,34,42H,12,19-24H2,1-4H3,(H,38,45)(H,39,44)(H,40,43)/t28-,31-,32-,33-;30-,31-,32-,34-/m00/s1 |
| InChIKey | OFFWOVJBSQMVPI-RMLGOCCBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Kaletra (CHEBI:145924) has part lopinavir (CHEBI:31781) |
| Kaletra (CHEBI:145924) has part ritonavir (CHEBI:45409) |
| Kaletra (CHEBI:145924) has role anticoronaviral agent (CHEBI:149553) |
| Kaletra (CHEBI:145924) has role antiviral drug (CHEBI:36044) |
| Kaletra (CHEBI:145924) has role HIV protease inhibitor (CHEBI:35660) |
| Kaletra (CHEBI:145924) is a mixture (CHEBI:60004) |
| Synonyms | Source |
|---|---|
| ABT-378 & ABT-538 | ChEBI |
| lopinavir and ritonavir | KEGG DRUG |
| lopinavir mixture with ritonavir | ChEBI |
| lopinavir & ritonavir | ChEBI |
| lopinavir-ritonavir | ChEBI |
| lopinavir/ritonavir | ChemIDplus |
| Brand Names | Source |
|---|---|
| Aluvia | ChemIDplus |
| Kaletra | ChemIDplus |
| Lopimune | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D02498 | KEGG DRUG |
| Lopinavir/ritonavir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:369372-47-4 | ChemIDplus |
| Citations |
|---|