EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H48N6O5S2 |
| Net Charge | 0 |
| Average Mass | 720.962 |
| Monoisotopic Mass | 720.31276 |
| SMILES | CC(C)c1nc(CN(C)C(=O)N[C@H](C(=O)N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)C(C)C)cs1 |
| InChI | InChI=1S/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46)/t28-,31-,32-,33-/m0/s1 |
| InChIKey | NCDNCNXCDXHOMX-XGKFQTDJSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. antiviral drug A substance used in the prophylaxis or therapy of virus diseases. HIV protease inhibitor An inhibitor of HIV protease, an enzyme required for production of proteins needed for viral assembly. |
| Application: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ritonavir (CHEBI:45409) has role antiviral drug (CHEBI:36044) |
| ritonavir (CHEBI:45409) has role environmental contaminant (CHEBI:78298) |
| ritonavir (CHEBI:45409) has role HIV protease inhibitor (CHEBI:35660) |
| ritonavir (CHEBI:45409) has role xenobiotic (CHEBI:35703) |
| ritonavir (CHEBI:45409) is a L-valine derivative (CHEBI:84129) |
| ritonavir (CHEBI:45409) is a 1,3-thiazoles (CHEBI:38418) |
| ritonavir (CHEBI:45409) is a carbamate ester (CHEBI:23003) |
| ritonavir (CHEBI:45409) is a carboxamide (CHEBI:37622) |
| ritonavir (CHEBI:45409) is a ureas (CHEBI:47857) |
| Incoming Relation(s) |
| Kaletra (CHEBI:145924) has part ritonavir (CHEBI:45409) |
| Paxlovid (CHEBI:192712) has part ritonavir (CHEBI:45409) |
| Technivie (CHEBI:90919) has part ritonavir (CHEBI:45409) |
| Viekira Pak (CHEBI:85177) has part ritonavir (CHEBI:45409) |
| IUPAC Name |
|---|
| N-[(2S,4S,5S)-4-hydroxy-1,6-diphenyl-5-{[(1,3-thiazol-5-ylmethoxy)carbonyl]amino}hexan-2-yl]-N2-(methyl{[2-(propan-2-yl)-1,3-thiazol-4-yl]methyl}carbamoyl)-L-valinamide |
| INN | Source |
|---|---|
| ritonavir | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:768009 | Reaxys |
| CAS:155213-67-5 | ChemIDplus |
| CAS:155213-67-5 | KEGG COMPOUND |
| Citations |
|---|