EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H35O5 |
| Net Charge | -1 |
| Average Mass | 355.495 |
| Monoisotopic Mass | 355.24900 |
| SMILES | CCCCC[C@H](O)CC[C@@H]1[C@@H](C/C=C\CCCC(=O)[O-])[C@@H](O)C[C@H]1O |
| InChI | InChI=1S/C20H36O5/c1-2-3-6-9-15(21)12-13-17-16(18(22)14-19(17)23)10-7-4-5-8-11-20(24)25/h4,7,15-19,21-23H,2-3,5-6,8-14H2,1H3,(H,24,25)/p-1/b7-4-/t15-,16+,17+,18-,19+/m0/s1 |
| InChIKey | LLQBSJQTCKVWTD-NFUXFLSFSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13,14-dihydroprostaglandin F2α(1−) (CHEBI:133376) is a prostaglandin carboxylic acid anion (CHEBI:59326) |
| 13,14-dihydroprostaglandin F2α(1−) (CHEBI:133376) is conjugate base of 13,14-dihydroprostaglandin F2α (CHEBI:88346) |
| Incoming Relation(s) |
| 13,14-dihydroprostaglandin F2α (CHEBI:88346) is conjugate acid of 13,14-dihydroprostaglandin F2α(1−) (CHEBI:133376) |
| IUPAC Name |
|---|
| (5Z,9α,11α,15S)-9,11,15-trihydroxyprost-5-en-1-oate |
| Synonym | Source |
|---|---|
| 13,14-dihydro-PGF2α(1−) | ChEBI |