EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N3O5S |
| Net Charge | -1 |
| Average Mass | 350.376 |
| Monoisotopic Mass | 350.08162 |
| SMILES | COc1cc(/N=N/c2ccc(OC)c(S(=O)(=O)[O-])c2)c(C)cc1N |
| InChI | InChI=1S/C15H17N3O5S/c1-9-6-11(16)14(23-3)8-12(9)18-17-10-4-5-13(22-2)15(7-10)24(19,20)21/h4-8H,16H2,1-3H3,(H,19,20,21)/p-1/b18-17+ |
| InChIKey | IEZSGDNUYFXTGX-ISLYRVAYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) is a organosulfonate oxoanion (CHEBI:33554) |
| 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) is conjugate base of Sirius scarlet GG (acid form) (CHEBI:88210) |
| Incoming Relation(s) |
| Sirius scarlet GG (CHEBI:88209) has part 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is conjugate acid of 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) |
| IUPAC Name |
|---|
| 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Direct red 76(1−) | ChEBI |
| Sirius scarlet GG(1−) | ChEBI |
| Sirius supra scarlet GG(1−) | ChEBI |