EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H17N3O5S |
| Net Charge | 0 |
| Average Mass | 351.384 |
| Monoisotopic Mass | 351.08889 |
| SMILES | COc1cc(/N=N/c2ccc(OC)c(S(=O)(=O)O)c2)c(C)cc1N |
| InChI | InChI=1S/C15H17N3O5S/c1-9-6-11(16)14(23-3)8-12(9)18-17-10-4-5-13(22-2)15(7-10)24(19,20)21/h4-8H,16H2,1-3H3,(H,19,20,21)/b18-17+ |
| InChIKey | IEZSGDNUYFXTGX-ISLYRVAYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sirius scarlet GG (acid form) (CHEBI:88210) has role fluorochrome (CHEBI:51217) |
| Sirius scarlet GG (acid form) (CHEBI:88210) has role histological dye (CHEBI:77178) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is a arenesulfonic acid (CHEBI:33555) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is a aromatic ether (CHEBI:35618) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is a azobenzenes (CHEBI:22682) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is a substituted aniline (CHEBI:48975) |
| Sirius scarlet GG (acid form) (CHEBI:88210) is conjugate acid of 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) |
| Incoming Relation(s) |
| 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) is conjugate base of Sirius scarlet GG (acid form) (CHEBI:88210) |
| IUPAC Name |
|---|
| 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 5-((4-Amino-5-methoxy-o-tolyl)azo)-2-methoxybenzenesulphonic acid | ChemIDplus |
| Direct red 76 (acid form) | ChEBI |
| Direct red 76 free acid | ChEBI |
| Sirius scarlet GG free acid | ChEBI |
| Sirius supra scarlet GG (acid form) | ChEBI |
| Sirius supra scarlet GG free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:63216-83-1 | ChemIDplus |