EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H16N3O5S.Na |
| Net Charge | 0 |
| Average Mass | 373.366 |
| Monoisotopic Mass | 373.07084 |
| SMILES | COc1cc(/N=N/c2ccc(OC)c(S(=O)(=O)[O-])c2)c(C)cc1N.[Na+] |
| InChI | InChI=1S/C15H17N3O5S.Na/c1-9-6-11(16)14(23-3)8-12(9)18-17-10-4-5-13(22-2)15(7-10)24(19,20)21;/h4-8H,16H2,1-3H3,(H,19,20,21);/q;+1/p-1/b18-17+; |
| InChIKey | VEZPAKWJFJTJJA-ZAGWXBKKSA-M |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sirius scarlet GG (CHEBI:88209) has part 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate (CHEBI:88211) |
| Sirius scarlet GG (CHEBI:88209) has role fluorochrome (CHEBI:51217) |
| Sirius scarlet GG (CHEBI:88209) has role histological dye (CHEBI:77178) |
| Sirius scarlet GG (CHEBI:88209) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium 5-[(4-amino-5-methoxy-2-methylphenyl)diazenyl]-2-methoxybenzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| C.I. 40270 | ChEBI |
| Direct red 76 | ChEBI |
| Durazol scarlet 2G | ChEBI |
| Sirius supra scarlet GG | ChEBI |
| Sodium 5-((4-amino-5-methoxy-o-tolyl)azo)-2-methoxybenzenesulphonate | ChemIDplus |
| Solantine scarlet G | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1937-40-2 | ChemIDplus |
| Citations |
|---|