EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H21N5O7S2 |
| Net Charge | -2 |
| Average Mass | 651.682 |
| Monoisotopic Mass | 651.08934 |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(=O)(=O)[O-])c5ccccc5c4O)cc3)cc2)cc(S(=O)(=O)[O-])c2ccccc12 |
| InChI | InChI=1S/C32H23N5O7S2/c33-31-25-7-3-1-5-23(25)29(45(39,40)41)17-27(31)36-34-21-13-9-19(10-14-21)20-11-15-22(16-12-20)35-37-28-18-30(46(42,43)44)24-6-2-4-8-26(24)32(28)38/h1-18,38H,33H2,(H,39,40,41)(H,42,43,44)/p-2/b36-34+,37-35+ |
| InChIKey | TZCACGMZCLGYSG-VHJMTFITSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Congo corinth(2−) (CHEBI:88204) is a organosulfonate oxoanion (CHEBI:33554) |
| Congo corinth(2−) (CHEBI:88204) is conjugate base of Congo corinth (acid form) (CHEBI:88203) |
| Incoming Relation(s) |
| Congo corinth (CHEBI:88202) has part Congo corinth(2−) (CHEBI:88204) |
| Congo corinth (acid form) (CHEBI:88203) is conjugate acid of Congo corinth(2−) (CHEBI:88204) |
| IUPAC Name |
|---|
| 3-({4'-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl][1,1'-biphenyl]-4-yl}diazenyl)-4-hydroxynaphthalene-1-sulfonate |
| Synonym | Source |
|---|---|
| Congo corinth dianion | ChEBI |