EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H23N5O7S2 |
| Net Charge | 0 |
| Average Mass | 653.698 |
| Monoisotopic Mass | 653.10389 |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(=O)(=O)O)c5ccccc5c4O)cc3)cc2)cc(S(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C32H23N5O7S2/c33-31-25-7-3-1-5-23(25)29(45(39,40)41)17-27(31)36-34-21-13-9-19(10-14-21)20-11-15-22(16-12-20)35-37-28-18-30(46(42,43)44)24-6-2-4-8-26(24)32(28)38/h1-18,38H,33H2,(H,39,40,41)(H,42,43,44)/b36-34+,37-35+ |
| InChIKey | TZCACGMZCLGYSG-VHJMTFITSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Congo corinth (acid form) (CHEBI:88203) has role fluorochrome (CHEBI:51217) |
| Congo corinth (acid form) (CHEBI:88203) has role histological dye (CHEBI:77178) |
| Congo corinth (acid form) (CHEBI:88203) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| Congo corinth (acid form) (CHEBI:88203) is a azobenzenes (CHEBI:22682) |
| Congo corinth (acid form) (CHEBI:88203) is a bis(azo) compound (CHEBI:48960) |
| Congo corinth (acid form) (CHEBI:88203) is a naphthols (CHEBI:25392) |
| Congo corinth (acid form) (CHEBI:88203) is a ring assembly (CHEBI:36820) |
| Congo corinth (acid form) (CHEBI:88203) is conjugate acid of Congo corinth(2−) (CHEBI:88204) |
| Incoming Relation(s) |
| Congo corinth(2−) (CHEBI:88204) is conjugate base of Congo corinth (acid form) (CHEBI:88203) |
| IUPAC Name |
|---|
| 3-({4'-[(1-amino-4-sulfonaphthalen-2-yl)diazenyl][1,1'-biphenyl]-4-yl}diazenyl)-4-hydroxynaphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| Congo corinth free acid | ChEBI |
| Direct red 10 (acid form) | ChEBI |
| Direct red 10 free acid | ChEBI |