EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H21N5O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 697.662 |
| Monoisotopic Mass | 697.06778 |
| SMILES | Nc1c(/N=N/c2ccc(-c3ccc(/N=N/c4cc(S(=O)(=O)[O-])c5ccccc5c4O)cc3)cc2)cc(S(=O)(=O)[O-])c2ccccc12.[Na+].[Na+] |
| InChI | InChI=1S/C32H23N5O7S2.2Na/c33-31-25-7-3-1-5-23(25)29(45(39,40)41)17-27(31)36-34-21-13-9-19(10-14-21)20-11-15-22(16-12-20)35-37-28-18-30(46(42,43)44)24-6-2-4-8-26(24)32(28)38;;/h1-18,38H,33H2,(H,39,40,41)(H,42,43,44);;/q;2*+1/p-2/b36-34+,37-35+;; |
| InChIKey | ZWYHVBGOBINPHN-AVRYKWKFSA-L |
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Congo corinth (CHEBI:88202) has part Congo corinth(2−) (CHEBI:88204) |
| Congo corinth (CHEBI:88202) has role fluorochrome (CHEBI:51217) |
| Congo corinth (CHEBI:88202) has role histological dye (CHEBI:77178) |
| Congo corinth (CHEBI:88202) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 3-({4'-[(1-amino-4-sulfonatonaphthalen-2-yl)diazenyl][1,1'-biphenyl]-4-yl}diazenyl)-4-hydroxynaphthalene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Erie garnet B | ChEBI |
| Direct red 10 | ChEBI |
| Congo corinth G | ChEBI |
| C.I. 22145 | ChEBI |
| Disodium 4-amino-3-((4'-((1-hydroxy-4-sulphonato-2-naphthyl)azo)(1,1'-biphenyl)-4-yl)azo)naphthalene-1-sulphonate | ChemIDplus |
| C.I. Direct Red 10 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| CAS:2429-70-1 | ChemIDplus |
| Citations |
|---|