EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H19N5O8S2 |
| Net Charge | -2 |
| Average Mass | 629.632 |
| Monoisotopic Mass | 629.06860 |
| SMILES | O=C(Nc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)[O-])cc4)cc3)c(S(=O)(=O)[O-])cc2c1)c1ccccc1 |
| InChI | InChI=1S/C29H21N5O8S2/c35-28-25-15-12-23(30-29(36)18-4-2-1-3-5-18)16-19(25)17-26(44(40,41)42)27(28)34-33-21-8-6-20(7-9-21)31-32-22-10-13-24(14-11-22)43(37,38)39/h1-17,35H,(H,30,36)(H,37,38,39)(H,40,41,42)/p-2/b32-31+,34-33+ |
| InChIKey | IGXZMQCLUNTWCC-HSBKYFPUSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sirius red 4B(2−) (CHEBI:88193) is a organosulfonate oxoanion (CHEBI:33554) |
| Sirius red 4B(2−) (CHEBI:88193) is conjugate base of Sirius red 4B (acid form) (CHEBI:88192) |
| Incoming Relation(s) |
| Sirius red 4B (CHEBI:88191) has part Sirius red 4B(2−) (CHEBI:88193) |
| Sirius red 4B (acid form) (CHEBI:88192) is conjugate acid of Sirius red 4B(2−) (CHEBI:88193) |
| IUPAC Name |
|---|
| 7-benzamido-4-hydroxy-3-({4-[(4-sulfonatophenyl)diazenyl]phenyl}diazenyl)naphthalene-2-sulfonate |
| Synonym | Source |
|---|---|
| Sirius red 4B dianion | ChEBI |