EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H19N5O8S2.2Na |
| Net Charge | 0 |
| Average Mass | 675.612 |
| Monoisotopic Mass | 675.04704 |
| SMILES | O=C(Nc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)[O-])cc4)cc3)c(S(=O)(=O)[O-])cc2c1)c1ccccc1.[Na+].[Na+] |
| InChI | InChI=1S/C29H21N5O8S2.2Na/c35-28-25-15-12-23(30-29(36)18-4-2-1-3-5-18)16-19(25)17-26(44(40,41)42)27(28)34-33-21-8-6-20(7-9-21)31-32-22-10-13-24(14-11-22)43(37,38)39;;/h1-17,35H,(H,30,36)(H,37,38,39)(H,40,41,42);;/q;2*+1/p-2/b32-31+,34-33+;; |
| InChIKey | UFUQRRYHIHJMPB-DUCFOALUSA-L |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sirius red 4B (CHEBI:88191) has part Sirius red 4B(2−) (CHEBI:88193) |
| Sirius red 4B (CHEBI:88191) has role environmental contaminant (CHEBI:78298) |
| Sirius red 4B (CHEBI:88191) has role fluorochrome (CHEBI:51217) |
| Sirius red 4B (CHEBI:88191) has role histological dye (CHEBI:77178) |
| Sirius red 4B (CHEBI:88191) has role poison (CHEBI:64909) |
| Sirius red 4B (CHEBI:88191) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 7-benzamido-4-hydroxy-3-({4-[(4-sulfonatophenyl)diazenyl]phenyl}diazenyl)naphthalene-2-sulfonate |
| Synonyms | Source |
|---|---|
| Chlorantine fast red 5B | ChEBI |
| C.I. 28160 | ChEBI |
| C.I. Direct Red 81 | ChemIDplus |
| C.I. Direct Red 81 disodium salt | ChemIDplus |
| Direct red 81 | ChEBI |
| Disodium 7-benzamido-4-hydroxy-3-((4-((4-sulphonatophenyl)azo)phenyl)azo)naphthalene-2-sulphonate | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3894142 | Reaxys |
| CAS:2610-11-9 | ChemIDplus |
| Citations |
|---|