EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H21N5O8S2 |
| Net Charge | 0 |
| Average Mass | 631.648 |
| Monoisotopic Mass | 631.08315 |
| SMILES | O=C(Nc1ccc2c(O)c(/N=N/c3ccc(/N=N/c4ccc(S(=O)(=O)O)cc4)cc3)c(S(=O)(=O)O)cc2c1)c1ccccc1 |
| InChI | InChI=1S/C29H21N5O8S2/c35-28-25-15-12-23(30-29(36)18-4-2-1-3-5-18)16-19(25)17-26(44(40,41)42)27(28)34-33-21-8-6-20(7-9-21)31-32-22-10-13-24(14-11-22)43(37,38)39/h1-17,35H,(H,30,36)(H,37,38,39)(H,40,41,42)/b32-31+,34-33+ |
| InChIKey | IGXZMQCLUNTWCC-HSBKYFPUSA-N |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Role: | poison Any substance that causes disturbance to organisms by chemical reaction or other activity on the molecular scale, when a sufficient quantity is absorbed by the organism. |
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sirius red 4B (acid form) (CHEBI:88192) has role environmental contaminant (CHEBI:78298) |
| Sirius red 4B (acid form) (CHEBI:88192) has role fluorochrome (CHEBI:51217) |
| Sirius red 4B (acid form) (CHEBI:88192) has role histological dye (CHEBI:77178) |
| Sirius red 4B (acid form) (CHEBI:88192) has role poison (CHEBI:64909) |
| Sirius red 4B (acid form) (CHEBI:88192) is a azobenzenes (CHEBI:22682) |
| Sirius red 4B (acid form) (CHEBI:88192) is a benzamides (CHEBI:22702) |
| Sirius red 4B (acid form) (CHEBI:88192) is a bis(azo) compound (CHEBI:48960) |
| Sirius red 4B (acid form) (CHEBI:88192) is a naphthalenesulfonic acid (CHEBI:36336) |
| Sirius red 4B (acid form) (CHEBI:88192) is a naphthols (CHEBI:25392) |
| Sirius red 4B (acid form) (CHEBI:88192) is conjugate acid of Sirius red 4B(2−) (CHEBI:88193) |
| Incoming Relation(s) |
| Sirius red 4B(2−) (CHEBI:88193) is conjugate base of Sirius red 4B (acid form) (CHEBI:88192) |
| IUPAC Name |
|---|
| 7-benzamido-4-hydroxy-3-({4-[(4-sulfophenyl)diazenyl]phenyl}diazenyl)naphthalene-2-sulfonic acid |
| Synonyms | Source |
|---|---|
| 7-(Benzoylamino)-4-hydroxy-3-((4-((4-sulfophenyl)azo)phenyl)azo)-2-naphthalenesulfonic acid | ChemIDplus |
| Direct Red 81 (acid form) | ChEBI |
| Direct Red 81 free acid | ChEBI |
| Sirius red 4B free acid | ChEBI |
| Solaminrot 4B (acid form) | ChEBI |
| Solaminrot 4B free acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:25188-42-5 | ChemIDplus |