EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N4 |
| Net Charge | +1 |
| Average Mass | 287.346 |
| Monoisotopic Mass | 287.12912 |
| SMILES | Nc1ccc2nc3ccc(N)cc3[n+](-c3ccccc3)c2c1 |
| InChI | InChI=1S/C18H14N4/c19-12-6-8-15-17(10-12)22(14-4-2-1-3-5-14)18-11-13(20)7-9-16(18)21-15/h1-11H,(H3,19,20)/p+1 |
| InChIKey | GCJIBOGVEKFXNS-UHFFFAOYSA-O |
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) has role fluorochrome (CHEBI:51217) |
| 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) has role histological dye (CHEBI:77178) |
| 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) is a organic cation (CHEBI:25697) |
| 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) is a phenazines (CHEBI:39201) |
| Incoming Relation(s) |
| phenosafranine (CHEBI:33601) has part 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) |
| IUPAC Name |
|---|
| 3,7-diamino-5-phenylphenazin-5-ium |