EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N4.Cl |
| Net Charge | 0 |
| Average Mass | 322.799 |
| Monoisotopic Mass | 322.09852 |
| SMILES | Nc1ccc2nc3ccc(N)cc3[n+](-c3ccccc3)c2c1.[Cl-] |
| InChI | InChI=1S/C18H14N4.ClH/c19-12-6-8-15-17(10-12)22(14-4-2-1-3-5-14)18-11-13(20)7-9-16(18)21-15;/h1-11H,(H3,19,20);1H |
| InChIKey | SOUHUMACVWVDME-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | photosensitizing agent A chemical compound that can be excited by light of a specific wavelength and subsequently transfer energy to a chosen reactant. This is commonly molecular oxygen within a cancer tissue, which is converted to (highly rective) singlet state oxygen. This rapidly reacts with any nearby biomolecules, ultimately killing the cancer cells. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| phenosafranine (CHEBI:33601) has part 3,7-diamino-5-phenylphenazin-5-ium (CHEBI:88009) |
| phenosafranine (CHEBI:33601) has role fluorochrome (CHEBI:51217) |
| phenosafranine (CHEBI:33601) has role histological dye (CHEBI:77178) |
| phenosafranine (CHEBI:33601) has role photosensitizing agent (CHEBI:47868) |
| phenosafranine (CHEBI:33601) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 3,7-diamino-5-phenylphenazin-5-ium chloride |
| Synonyms | Source |
|---|---|
| 3,7-diamino-5-phenylphenazinium chloride | ChemIDplus |
| C.I. 50200 | ChEBI |
| phenosafranin | ChemIDplus |
| phenosafranine | ChEBI |
| phenosafranine, chloride | ChemIDplus |
| safranin B extra | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3642082 | Reaxys |
| CAS:81-93-6 | ChemIDplus |
| Citations |
|---|