EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H24N6O14S4 |
| Net Charge | -4 |
| Average Mass | 868.862 |
| Monoisotopic Mass | 868.02553 |
| SMILES | Cc1cc(-c2ccc(/N=N/c3ccc4c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c(N)c4c3O)c(C)c2)ccc1/N=N/c1ccc2c(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c(N)c2c1O |
| InChI | InChI=1S/C34H28N6O14S4/c1-15-11-17(3-7-21(15)37-39-23-9-5-19-25(55(43,44)45)13-27(57(49,50)51)31(35)29(19)33(23)41)18-4-8-22(16(2)12-18)38-40-24-10-6-20-26(56(46,47)48)14-28(58(52,53)54)32(36)30(20)34(24)42/h3-14,41-42H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54)/p-4/b39-37+,40-38+ |
| InChIKey | COXVTLYNGOIATD-HVMBLDELSA-J |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Evans blue(4−) (CHEBI:87636) is a organosulfonate oxoanion (CHEBI:33554) |
| Evans blue(4−) (CHEBI:87636) is conjugate base of Evans blue free acid (CHEBI:87634) |
| Incoming Relation(s) |
| Evans blue (CHEBI:82467) has part Evans blue(4−) (CHEBI:87636) |
| Evans blue free acid (CHEBI:87634) is conjugate acid of Evans blue(4−) (CHEBI:87636) |
| IUPAC Name |
|---|
| 6,6'-{(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis[diazene-2,1-diyl]}bis(4-amino-5-hydroxynaphthalene-1,3-disulfonate) |
| Synonyms | Source |
|---|---|
| Evans blue anion | ChEBI |
| Evans blue tetraanion | ChEBI |