EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H28N6O14S4 |
| Net Charge | 0 |
| Average Mass | 872.894 |
| Monoisotopic Mass | 872.05463 |
| SMILES | Cc1cc(-c2ccc(N=Nc3ccc4c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c4c3O)c(C)c2)ccc1N=Nc1ccc2c(S(=O)(=O)O)cc(S(=O)(=O)O)c(N)c2c1O |
| InChI | InChI=1S/C34H28N6O14S4/c1-15-11-17(3-7-21(15)37-39-23-9-5-19-25(55(43,44)45)13-27(57(49,50)51)31(35)29(19)33(23)41)18-4-8-22(16(2)12-18)38-40-24-10-6-20-26(56(46,47)48)14-28(58(52,53)54)32(36)30(20)34(24)42/h3-14,41-42H,35-36H2,1-2H3,(H,43,44,45)(H,46,47,48)(H,49,50,51)(H,52,53,54) |
| InChIKey | COXVTLYNGOIATD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | sodium channel blocker An agent that inhibits sodium influx through cell membranes. teratogenic agent A role played by a chemical compound in biological systems with adverse consequences in embryo developments, leading to birth defects, embryo death or altered development, growth retardation and functional defect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Evans blue free acid (CHEBI:87634) has role sodium channel blocker (CHEBI:38633) |
| Evans blue free acid (CHEBI:87634) has role teratogenic agent (CHEBI:50905) |
| Evans blue free acid (CHEBI:87634) is a aminonaphthalene (CHEBI:38034) |
| Evans blue free acid (CHEBI:87634) is a azobenzenes (CHEBI:22682) |
| Evans blue free acid (CHEBI:87634) is a biphenyls (CHEBI:22888) |
| Evans blue free acid (CHEBI:87634) is a bis(azo) compound (CHEBI:48960) |
| Evans blue free acid (CHEBI:87634) is a naphthalenesulfonic acid (CHEBI:36336) |
| Evans blue free acid (CHEBI:87634) is a naphthols (CHEBI:25392) |
| Evans blue free acid (CHEBI:87634) is a primary arylamine (CHEBI:50471) |
| Evans blue free acid (CHEBI:87634) is conjugate acid of Evans blue(4−) (CHEBI:87636) |
| Incoming Relation(s) |
| Evans blue(4−) (CHEBI:87636) is conjugate base of Evans blue free acid (CHEBI:87634) |
| IUPAC Name |
|---|
| 6,6'-{(3,3'-dimethyl[1,1'-biphenyl]-4,4'-diyl)bis[diazene-2,1-diyl]}bis(4-amino-5-hydroxynaphthalene-1,3-disulfonic acid) |
| Synonyms | Source |
|---|---|
| Evans blue acid | ChEBI |
| Evans blue free acid form | ChEBI |
| NSC 8680 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1838846 | Reaxys |
| CAS:6968-33-8 | ChemIDplus |