EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14N4O7S2 |
| Net Charge | -2 |
| Average Mass | 510.509 |
| Monoisotopic Mass | 510.03149 |
| SMILES | O=S(=O)([O-])c1ccc(N=Nc2ccc(N=Nc3c(O)ccc4ccccc34)c(S(=O)(=O)[O-])c2)cc1 |
| InChI | InChI=1S/C22H16N4O7S2/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30/h1-13,27H,(H,28,29,30)(H,31,32,33)/p-2 |
| InChIKey | BYABGQJPCPYPSZ-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biebrich scarlet(2−) (CHEBI:87188) is a organosulfonate oxoanion (CHEBI:33554) |
| Biebrich scarlet(2−) (CHEBI:87188) is conjugate base of Biebrich scarlet (acid form) (CHEBI:87187) |
| Incoming Relation(s) |
| Biebrich scarlet (CHEBI:87186) has part Biebrich scarlet(2−) (CHEBI:87188) |
| Biebrich scarlet (acid form) (CHEBI:87187) is conjugate acid of Biebrich scarlet(2−) (CHEBI:87188) |
| IUPAC Name |
|---|
| 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| Biebrich scarlet anion | ChEBI |
| Biebrich scarlet dianion | ChEBI |