EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H14N4O7S2.2Na |
| Net Charge | 0 |
| Average Mass | 556.489 |
| Monoisotopic Mass | 556.00993 |
| SMILES | O=S(=O)([O-])c1ccc(N=Nc2ccc(N=Nc3c(O)ccc4ccccc34)c(S(=O)(=O)[O-])c2)cc1.[Na+].[Na+] |
| InChI | InChI=1S/C22H16N4O7S2.2Na/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30;;/h1-13,27H,(H,28,29,30)(H,31,32,33);;/q;2*+1/p-2 |
| InChIKey | VVAVKBBTPWYADW-UHFFFAOYSA-L |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biebrich scarlet (CHEBI:87186) has part Biebrich scarlet(2−) (CHEBI:87188) |
| Biebrich scarlet (CHEBI:87186) has role histological dye (CHEBI:77178) |
| Biebrich scarlet (CHEBI:87186) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| disodium 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfonatophenyl)diazenyl]benzene-1-sulfonate |
| Synonyms | Source |
|---|---|
| acid red 66 | ChEBI |
| Acid Scarlet BA | ChemIDplus |
| Amacid Chrome Red 3B | ChemIDplus |
| Calcochrome Red 650 | ChemIDplus |
| C.I. 26905 | ChEBI |
| C.I. Acid Red 66 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Biebrich_scarlet | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3883900 | Reaxys |
| CAS:4196-99-0 | ChemIDplus |