EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H16N4O7S2 |
| Net Charge | 0 |
| Average Mass | 512.525 |
| Monoisotopic Mass | 512.04604 |
| SMILES | O=S(=O)(O)c1ccc(N=Nc2ccc(N=Nc3c(O)ccc4ccccc34)c(S(=O)(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H16N4O7S2/c27-20-12-5-14-3-1-2-4-18(14)22(20)26-25-19-11-8-16(13-21(19)35(31,32)33)24-23-15-6-9-17(10-7-15)34(28,29)30/h1-13,27H,(H,28,29,30)(H,31,32,33) |
| InChIKey | BYABGQJPCPYPSZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Biebrich scarlet (acid form) (CHEBI:87187) has role histological dye (CHEBI:77178) |
| Biebrich scarlet (acid form) (CHEBI:87187) is a arenesulfonic acid (CHEBI:33555) |
| Biebrich scarlet (acid form) (CHEBI:87187) is a azobenzenes (CHEBI:22682) |
| Biebrich scarlet (acid form) (CHEBI:87187) is a bis(azo) compound (CHEBI:48960) |
| Biebrich scarlet (acid form) (CHEBI:87187) is a naphthols (CHEBI:25392) |
| Biebrich scarlet (acid form) (CHEBI:87187) is conjugate acid of Biebrich scarlet(2−) (CHEBI:87188) |
| Incoming Relation(s) |
| Biebrich scarlet(2−) (CHEBI:87188) is conjugate base of Biebrich scarlet (acid form) (CHEBI:87187) |
| IUPAC Name |
|---|
| 2-[(2-hydroxynaphthalen-1-yl)diazenyl]-5-[(4-sulfophenyl)diazenyl]benzene-1-sulfonic acid |
| Synonym | Source |
|---|---|
| acid red 66 (free acid form) | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Biebrich_scarlet | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3229970 | Reaxys |