EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30ClN3O |
| Net Charge | 0 |
| Average Mass | 399.966 |
| Monoisotopic Mass | 399.20774 |
| SMILES | CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C23H30ClN3O/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26) |
| InChIKey | GPKJTRJOBQGKQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinacrine (CHEBI:8711) has parent hydride acridine (CHEBI:36420) |
| quinacrine (CHEBI:8711) has role antimalarial (CHEBI:38068) |
| quinacrine (CHEBI:8711) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| quinacrine (CHEBI:8711) is a acridines (CHEBI:22213) |
| quinacrine (CHEBI:8711) is a aromatic ether (CHEBI:35618) |
| quinacrine (CHEBI:8711) is a organochlorine compound (CHEBI:36683) |
| quinacrine (CHEBI:8711) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| quinacrine mustard (CHEBI:37595) has functional parent quinacrine (CHEBI:8711) |
| (R)-quinacrine (CHEBI:49845) is a quinacrine (CHEBI:8711) |
| (S)-quinacrine (CHEBI:37597) is a quinacrine (CHEBI:8711) |
| IUPAC Name |
|---|
| 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| Synonyms | Source |
|---|---|
| 2-methoxy-6-chloro-9-diethylaminopentylaminoacridine | ChemIDplus |
| 3-chloro-7-methoxy-9-(1-methyl-4-diethylaminobutylamino)acridine | ChemIDplus |
| 6-chloro-9-((4-(diethylamino)-1-methylbutyl)amino)-2-methoxyacridine | ChemIDplus |
| N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| mepacrine | ChemIDplus |
| Mepacrine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2338 | DrugCentral |
| ATABRINE | MetaCyc |
| C07339 | KEGG COMPOUND |
| D08179 | KEGG DRUG |
| DB01103 | DrugBank |
| HMDB0015235 | HMDB |
| LSM-1577 | LINCS |
| Quinacrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497807 | Beilstein |
| Reaxys:95500 | Reaxys |
| CAS:83-89-6 | ChemIDplus |
| CAS:83-89-6 | KEGG COMPOUND |
| Citations |
|---|