EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H30ClN3O |
| Net Charge | 0 |
| Average Mass | 399.966 |
| Monoisotopic Mass | 399.20774 |
| SMILES | CCN(CC)CCCC(C)Nc1c2ccc(Cl)cc2nc2ccc(OC)cc12 |
| InChI | InChI=1S/C23H30ClN3O/c1-5-27(6-2)13-7-8-16(3)25-23-19-11-9-17(24)14-22(19)26-21-12-10-18(28-4)15-20(21)23/h9-12,14-16H,5-8,13H2,1-4H3,(H,25,26) |
| InChIKey | GPKJTRJOBQGKQK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor An EC 1.8.1.* (oxidoreductase acting on sulfur group of donors, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of trypanothione-disulfide reductase (EC 1.8.1.12). antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Application: | antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| quinacrine (CHEBI:8711) has parent hydride acridine (CHEBI:36420) |
| quinacrine (CHEBI:8711) has role antimalarial (CHEBI:38068) |
| quinacrine (CHEBI:8711) has role EC 1.8.1.12 (trypanothione-disulfide reductase) inhibitor (CHEBI:77402) |
| quinacrine (CHEBI:8711) is a acridines (CHEBI:22213) |
| quinacrine (CHEBI:8711) is a aromatic ether (CHEBI:35618) |
| quinacrine (CHEBI:8711) is a organochlorine compound (CHEBI:36683) |
| quinacrine (CHEBI:8711) is a tertiary amino compound (CHEBI:50996) |
| Incoming Relation(s) |
| quinacrine mustard (CHEBI:37595) has functional parent quinacrine (CHEBI:8711) |
| (R)-quinacrine (CHEBI:49845) is a quinacrine (CHEBI:8711) |
| (S)-quinacrine (CHEBI:37597) is a quinacrine (CHEBI:8711) |
| IUPAC Name |
|---|
| 4-N-(6-chloro-2-methoxyacridin-9-yl)-1-N,1-N-diethylpentane-1,4-diamine |
| Synonyms | Source |
|---|---|
| 2-methoxy-6-chloro-9-diethylaminopentylaminoacridine | ChemIDplus |
| 3-chloro-7-methoxy-9-(1-methyl-4-diethylaminobutylamino)acridine | ChemIDplus |
| 6-chloro-9-((4-(diethylamino)-1-methylbutyl)amino)-2-methoxyacridine | ChemIDplus |
| N4-(6-chloro-2-methoxy-9-acridinyl)-N1,N1-diethyl-1,4-pentanediamine | ChemIDplus |
| mepacrine | ChemIDplus |
| Mepacrine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 2338 | DrugCentral |
| ATABRINE | MetaCyc |
| C07339 | KEGG COMPOUND |
| D08179 | KEGG DRUG |
| DB01103 | DrugBank |
| HMDB0015235 | HMDB |
| LSM-1577 | LINCS |
| Quinacrine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497807 | Beilstein |
| Reaxys:95500 | Reaxys |
| CAS:83-89-6 | ChemIDplus |
| CAS:83-89-6 | KEGG COMPOUND |
| Citations |
|---|