EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H9N |
| Net Charge | 0 |
| Average Mass | 179.222 |
| Monoisotopic Mass | 179.07350 |
| SMILES | c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H9N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-9H |
| InChIKey | DZBUGLKDJFMEHC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | genotoxin A role played by a chemical compound to induce direct or indirect DNA damage. Such damage can potentially lead to the formation of a malignant tumour, but DNA damage does not lead inevitably to the creation of cancerous cells. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acridine (CHEBI:36420) has role antineoplastic agent (CHEBI:35610) |
| acridine (CHEBI:36420) has role genotoxin (CHEBI:50902) |
| acridine (CHEBI:36420) is a acridines (CHEBI:22213) |
| acridine (CHEBI:36420) is a mancude organic heterotricyclic parent (CHEBI:36416) |
| acridine (CHEBI:36420) is a polycyclic heteroarene (CHEBI:38180) |
| Incoming Relation(s) |
| quinacrine (CHEBI:8711) has parent hydride acridine (CHEBI:36420) |
| IUPAC Name |
|---|
| acridine |
| Synonyms | Source |
|---|---|
| 10-azaanthracene | ChemIDplus |
| 2,3,5,6-dibenzopyridine | ChemIDplus |
| 2,3-benzoquinoline | ChemIDplus |
| 9-azaanthracene | ChemIDplus |
| acrydine | NIST Chemistry WebBook |
| Akridin | NIST Chemistry WebBook |
| Citations |
|---|