EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H11O4 |
| Net Charge | -1 |
| Average Mass | 207.205 |
| Monoisotopic Mass | 207.06628 |
| SMILES | COc1ccc(/C=C/C(=O)[O-])cc1OC |
| InChI | InChI=1S/C11H12O4/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H,12,13)/p-1/b6-4+ |
| InChIKey | HJBWJAPEBGSQPR-GQCTYLIASA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4-dimethoxy-(E)-cinnamate (CHEBI:229728) is a cinnamates (CHEBI:36091) |
| 3,4-dimethoxy-(E)-cinnamate (CHEBI:229728) is conjugate base of 3,4-dimethoxycinnamic acid (CHEBI:86549) |
| Incoming Relation(s) |
| 3,4-dimethoxycinnamic acid (CHEBI:86549) is conjugate acid of 3,4-dimethoxy-(E)-cinnamate (CHEBI:229728) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| Synonyms | Source |
|---|---|
| 3-(3,4-dimethoxyphenyl)-(E)-2-propenoate | ChEBI |
| 3,4-dimethoxycinnamate | ChEBI |
| 3,4-dimethoxy-trans-cinnamate | ChEBI |
| (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate | ChEBI |
| (E)-3,4-dimethoxycinnamate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3,4-dimethoxy-(E)-cinnamate | UniProt |
| Citations |
|---|