EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H10O7 |
| Net Charge | 0 |
| Average Mass | 194.139 |
| Monoisotopic Mass | 194.04265 |
| SMILES | O=C(O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)CO |
| WURCS | WURCS=2.0/1,1,0/[A121Oh]/1/ |
| InChI | InChI=1S/C6H10O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h3-5,7,9-11H,1H2,(H,12,13)/t3-,4+,5-/m0/s1 |
| InChIKey | IZSRJDGCGRAUAR-LMVFSUKVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Paracoccus laeviglucosivorans (ncbitaxon:1197861) | - | PubMed (23038265) | |
| Thermotoga maritima (ncbitaxon:2336) | - | PubMed (23441918) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) has functional parent L-gluconic acid (CHEBI:86359) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) has role bacterial metabolite (CHEBI:76969) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) has role marine metabolite (CHEBI:76507) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) is a hexonic acid (CHEBI:33752) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) is a ketogluconic acid (CHEBI:24967) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) is conjugate acid of 5-dehydro-L-gluconate (CHEBI:137108) |
| 5-dehydro-L-gluconic acid (CHEBI:137932) is enantiomer of 5-dehydro-D-gluconic acid (CHEBI:17426) |
| Incoming Relation(s) |
| 5-dehydro-L-gluconate (CHEBI:137108) is conjugate base of 5-dehydro-L-gluconic acid (CHEBI:137932) |
| 5-dehydro-D-gluconic acid (CHEBI:17426) is enantiomer of 5-dehydro-L-gluconic acid (CHEBI:137932) |
| IUPAC Name |
|---|
| L-xylo-hex-5-ulosonic acid |
| Synonyms | Source |
|---|---|
| 5-keto-L-gluconic acid | ChEBI |
| L-5-ketogluconic acid | ChEBI |
| L-5-oxogluconic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-14806 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1726806 | Reaxys |
| Citations |
|---|