EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H16NO2 |
| Net Charge | +1 |
| Average Mass | 194.254 |
| Monoisotopic Mass | 194.11756 |
| SMILES | CCCCOC(=O)c1ccc([NH3+])cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7H,2-3,8,12H2,1H3/p+1 |
| InChIKey | IUWVALYLNVXWKX-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butamben(1+) (CHEBI:86302) is a ammonium ion derivative (CHEBI:35274) |
| butamben(1+) (CHEBI:86302) is conjugate acid of butamben (CHEBI:3231) |
| Incoming Relation(s) |
| butamben picrate (CHEBI:86300) has part butamben(1+) (CHEBI:86302) |
| butamben (CHEBI:3231) is conjugate base of butamben(1+) (CHEBI:86302) |