EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | 2C11H15NO2.C6H3N3O7 |
| Net Charge | 0 |
| Average Mass | 615.596 |
| Monoisotopic Mass | 615.21766 |
| SMILES | CCCCOC(=O)c1ccc(N)cc1.CCCCOC(=O)c1ccc(N)cc1.O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/2C11H15NO2.C6H3N3O7/c2*1-2-3-8-14-11(13)9-4-6-10(12)7-5-9;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h2*4-7H,2-3,8,12H2,1H3;1-2,10H |
| InChIKey | ATAGSVCDFKGYPE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butamben picrate (CHEBI:86300) has part butamben (CHEBI:3231) |
| butamben picrate (CHEBI:86300) has part butamben(1+) (CHEBI:86302) |
| butamben picrate (CHEBI:86300) has part picrate anion (CHEBI:86297) |
| butamben picrate (CHEBI:86300) has role local anaesthetic (CHEBI:36333) |
| butamben picrate (CHEBI:86300) is a organoammonium salt (CHEBI:46850) |
| Synonyms | Source |
|---|---|
| butyl aminobenzoate picrate | ChEBI |
| butyl aminobenzoate hemipicrate | ChEBI |
| butyl 4-aminobenzoate hemipicrate | ChEBI |
| butamben hemipicrate | ChEBI |
| Abbott 34842 | ChEBI |
| butyl 4-aminobenzoate picrate | ChEBI |
| Citations |
|---|