EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H15NO2 |
| Net Charge | 0 |
| Average Mass | 193.246 |
| Monoisotopic Mass | 193.11028 |
| SMILES | CCCCOC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C11H15NO2/c1-2-3-8-14-11(13)9-4-6-10(12)7-5-9/h4-7H,2-3,8,12H2,1H3 |
| InChIKey | IUWVALYLNVXWKX-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | local anaesthetic Any member of a group of drugs that reversibly inhibit the propagation of signals along nerves. Wide variations in potency, stability, toxicity, water-solubility and duration of action determine the route used for administration, e.g. topical, intravenous, epidural or spinal block. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butamben (CHEBI:3231) has functional parent 4-aminobenzoic acid (CHEBI:30753) |
| butamben (CHEBI:3231) has functional parent butan-1-ol (CHEBI:28885) |
| butamben (CHEBI:3231) has role local anaesthetic (CHEBI:36333) |
| butamben (CHEBI:3231) is a amino-acid ester (CHEBI:46668) |
| butamben (CHEBI:3231) is a benzoate ester (CHEBI:36054) |
| butamben (CHEBI:3231) is a primary amino compound (CHEBI:50994) |
| butamben (CHEBI:3231) is a substituted aniline (CHEBI:48975) |
| butamben (CHEBI:3231) is conjugate base of butamben(1+) (CHEBI:86302) |
| Incoming Relation(s) |
| butamben picrate (CHEBI:86300) has part butamben (CHEBI:3231) |
| butamben(1+) (CHEBI:86302) is conjugate acid of butamben (CHEBI:3231) |
| IUPAC Name |
|---|
| butyl 4-aminobenzoate |
| Synonyms | Source |
|---|---|
| 4-(butoxycarbonyl)aniline | ChemIDplus |
| n-butyl p-aminobenzoate | ChemIDplus |
| 4-aminobenzoic acid butyl ester | ChemIDplus |
| p-aminobenzoic acid butyl ester | ChemIDplus |
| butyl p-aminobenzoate | ChemIDplus |
| butyl aminobenzoate | ChEBI |
| Brand Names | Source |
|---|---|
| Planoform | ChemIDplus |
| Butesin | ChemIDplus |
| Butoform | ChemIDplus |
| Scuroform | ChemIDplus |
| Scuroforme | ChemIDplus |
| Citations |
|---|