EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N2O4P |
| Net Charge | 0 |
| Average Mass | 284.252 |
| Monoisotopic Mass | 284.09259 |
| SMILES | CN(C)CCc1cnc2cccc(OP(=O)(O)O)c12 |
| InChI | InChI=1S/C12H17N2O4P/c1-14(2)7-6-9-8-13-10-4-3-5-11(12(9)10)18-19(15,16)17/h3-5,8,13H,6-7H2,1-2H3,(H2,15,16,17) |
| InChIKey | QVDSEJDULKLHCG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psilocybe (ncbitaxon:71950) | - | PubMed (25007546) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | hallucinogen Drugs capable of inducing illusions, hallucinations, delusions, paranoid ideations and other alterations of mood and thinking. serotonergic agonist An agent that has an affinity for serotonin receptors and is able to mimic the effects of serotonin by stimulating the physiologic activity at the cell receptors. Serotonin agonists are used as antidepressants, anxiolytics, and in the treatment of migraine disorders. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| psilocybin (CHEBI:8614) has functional parent psilocin (CHEBI:8613) |
| psilocybin (CHEBI:8614) has role fungal metabolite (CHEBI:76946) |
| psilocybin (CHEBI:8614) has role hallucinogen (CHEBI:35499) |
| psilocybin (CHEBI:8614) has role prodrug (CHEBI:50266) |
| psilocybin (CHEBI:8614) has role serotonergic agonist (CHEBI:35941) |
| psilocybin (CHEBI:8614) is a organic phosphate (CHEBI:25703) |
| psilocybin (CHEBI:8614) is a tertiary amino compound (CHEBI:50996) |
| psilocybin (CHEBI:8614) is a tryptamine alkaloid (CHEBI:48274) |
| psilocybin (CHEBI:8614) is conjugate acid of psilocybin(1−) (CHEBI:139072) |
| Incoming Relation(s) |
| psilocybin(1−) (CHEBI:139072) is conjugate base of psilocybin (CHEBI:8614) |
| IUPAC Name |
|---|
| 3-[2-(dimethylamino)ethyl]-1H-indol-4-yl dihydrogen phosphate |
| INNs | Source |
|---|---|
| psilocibina | ChemIDplus |
| psilocybine | ChemIDplus |
| psilocybinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2-(Dimethylamino)ethyl)-1H-indol-4-ol dihydrogen phosphate ester | ChemIDplus |
| 3-(2-Dimethylaminoethyl)indol-4-yl dihydrogen phosphate | ChemIDplus |
| 4-phosphoryloxy-N,N-dimethyltryptamine | NIST Chemistry WebBook |
| O-phosphoryl-4-hydroxy-N,N-dimethyltryptamine | NIST Chemistry WebBook |
| Indocybin | ChemIDplus |
| psilocin phosphate ester | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C07576 | KEGG COMPOUND |
| Psilocybin | Wikipedia |
| Citations |
|---|