EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H12O5 |
| Net Charge | 0 |
| Average Mass | 284.267 |
| Monoisotopic Mass | 284.06847 |
| SMILES | COc1cc(O)c2c(=O)c(-c3ccc(O)cc3)coc2c1 |
| InChI | InChI=1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
| InChIKey | KQMVAGISDHMXJJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crotalaria lachnophora (IPNI:488342-1) | whole plant (BTO:0001461) | PubMed (21265557) | Chloroform soluble fraction of CH2Cl2/MeOH (1:1) crude extract of dried and powdered whole plant |
| Neolitsea daibuensis (IPNI:466954-1) | root (BTO:0001188) | PubMed (22148193) | Cold MeOH extract of dried roots |
| Roles Classification |
|---|
| Biological Roles: | EC 1.2.1.3 [aldehyde dehydrogenase (NAD(+))] inhibitor An EC 1.2.1.* (oxidoreductase acting on donor aldehyde/oxo group with NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of aldehyde dehydrogenase (NAD+), EC 1.2.1.3. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 1.3.1.22 [3-oxo-5alpha-steroid 4-dehydrogenase (NADP(+))] inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of of 3-oxo-5α-steroid 4-dehydrogenase (NADP+), EC 1.3.1.22, the enzyme which converts testosterone (CHEBI:17347) into the more potent androgen 5α-dihydrotestosterone. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| prunetin (CHEBI:8600) has functional parent genistein (CHEBI:28088) |
| prunetin (CHEBI:8600) has role anti-inflammatory agent (CHEBI:67079) |
| prunetin (CHEBI:8600) has role EC 1.2.1.3 [aldehyde dehydrogenase (NAD+)] inhibitor (CHEBI:35487) |
| prunetin (CHEBI:8600) has role EC 1.3.1.22 [3-oxo-5α-steroid 4-dehydrogenase (NADP+)] inhibitor (CHEBI:50781) |
| prunetin (CHEBI:8600) has role metabolite (CHEBI:25212) |
| prunetin (CHEBI:8600) is a 7-methoxyisoflavones (CHEBI:140356) |
| prunetin (CHEBI:8600) is a hydroxyisoflavone (CHEBI:38755) |
| prunetin (CHEBI:8600) is conjugate acid of prunetin-5-olate (CHEBI:147403) |
| Incoming Relation(s) |
| prunetin 4'-O-glucoside (CHEBI:78742) has functional parent prunetin (CHEBI:8600) |
| prunetin-5-olate (CHEBI:147403) is conjugate base of prunetin (CHEBI:8600) |
| IUPAC Name |
|---|
| 5-hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one |
| Synonyms | Source |
|---|---|
| 4',5-dihydroxy-7-methoxygenistein | ChEBI |
| 4',5-dihydroxy-7-methoxyisoflavone | ChEBI |
| 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4-benzopyrone | ChemIDplus |
| 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one | ChemIDplus |
| 7-O-methyl-genistein | ChEBI |
| Padmakastein | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C00002564 | KNApSAcK |
| C10521 | KEGG COMPOUND |
| CN101669935 | Patent |
| CPD-3521 | MetaCyc |
| HMDB0034127 | HMDB |
| LMPK12050353 | LIPID MAPS |
| LSM-3283 | LINCS |
| Prunetin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:292155 | Reaxys |
| CAS:552-59-0 | ChemIDplus |
| CAS:552-59-0 | KEGG COMPOUND |
| Citations |
|---|