EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N3O2 |
| Net Charge | +1 |
| Average Mass | 350.442 |
| Monoisotopic Mass | 350.18630 |
| SMILES | Cc1nc2ccccc2c1CC[NH2+]Cc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26/h2-11,22-23,26H,12-14H2,1H3,(H,24,25)/p+1/b11-10+ |
| InChIKey | FPOHNWQLNRZRFC-ZHACJKMWSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| panobinostat(1+) (CHEBI:85992) is a ammonium ion derivative (CHEBI:35274) |
| panobinostat(1+) (CHEBI:85992) is a organic cation (CHEBI:25697) |
| panobinostat(1+) (CHEBI:85992) is conjugate acid of panobinostat (CHEBI:85990) |
| Incoming Relation(s) |
| panobinostat lactate (CHEBI:85991) has part panobinostat(1+) (CHEBI:85992) |
| panobinostat (CHEBI:85990) is conjugate base of panobinostat(1+) (CHEBI:85992) |
| IUPAC Name |
|---|
| N-({4-[(1E)-3-(hydroxyamino)-3-oxoprop-1-en-1-yl]phenyl}methyl)-2-(2-methyl-1H-indol-3-yl)ethan-1-aminium |
| Synonym | Source |
|---|---|
| panobinostat cation | ChEBI |