EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O2.C3H6O3 |
| Net Charge | 0 |
| Average Mass | 439.512 |
| Monoisotopic Mass | 439.21072 |
| SMILES | CC(O)C(=O)O.Cc1nc2ccccc2c1CCNCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O2.C3H6O3/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26;1-2(4)3(5)6/h2-11,22-23,26H,12-14H2,1H3,(H,24,25);2,4H,1H3,(H,5,6)/b11-10+; |
| InChIKey | XVDWNSFFSMWXJJ-ASTDGNLGSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| panobinostat lactate (CHEBI:85991) has part panobinostat(1+) (CHEBI:85992) |
| panobinostat lactate (CHEBI:85991) has role angiogenesis modulating agent (CHEBI:50926) |
| panobinostat lactate (CHEBI:85991) has role antineoplastic agent (CHEBI:35610) |
| panobinostat lactate (CHEBI:85991) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| panobinostat lactate (CHEBI:85991) is a lactate salt (CHEBI:24997) |
| panobinostat lactate (CHEBI:85991) is a organoammonium salt (CHEBI:46850) |
| IUPAC Names |
|---|
| 2-hydroxypropanoic acid—(2E)-N-hydroxy-3-[4-({[2-(2-methyl-1H-indol-3-yl)ethyl]amino}methyl)phenyl]prop-2-enamide (1/1) |
| N-({4-[(1E)-3-(hydroxyamino)-3-oxoprop-1-en-1-yl]phenyl}methyl)-2-(2-methyl-1H-indol-3-yl)ethan-1-aminium 2-hydroxypropanoate |
| Brand Name | Source |
|---|---|
| Farydak | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| D10019 | KEGG DRUG |
| Panobinostat | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15615390 | Reaxys |
| CAS:960055-56-5 | ChemIDplus |
| Citations |
|---|