EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H23N3O2 |
| Net Charge | 0 |
| Average Mass | 349.434 |
| Monoisotopic Mass | 349.17903 |
| SMILES | Cc1nc2ccccc2c1CCNCc1ccc(/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C21H23N3O2/c1-15-18(19-4-2-3-5-20(19)23-15)12-13-22-14-17-8-6-16(7-9-17)10-11-21(25)24-26/h2-11,22-23,26H,12-14H2,1H3,(H,24,25)/b11-10+ |
| InChIKey | FPOHNWQLNRZRFC-ZHACJKMWSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | EC 3.5.1.98 (histone deacetylase) inhibitor An EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the function of histone deacetylase (EC 3.5.1.98). |
| Applications: | angiogenesis modulating agent An agent that modulates the physiologic angiogenesis process. This is accomplished by endogenous angiogenic proteins and a variety of other chemicals and pharmaceutical agents. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| panobinostat (CHEBI:85990) has role angiogenesis modulating agent (CHEBI:50926) |
| panobinostat (CHEBI:85990) has role antineoplastic agent (CHEBI:35610) |
| panobinostat (CHEBI:85990) has role EC 3.5.1.98 (histone deacetylase) inhibitor (CHEBI:61115) |
| panobinostat (CHEBI:85990) is a cinnamamides (CHEBI:23247) |
| panobinostat (CHEBI:85990) is a hydroxamic acid (CHEBI:24650) |
| panobinostat (CHEBI:85990) is a methylindole (CHEBI:38460) |
| panobinostat (CHEBI:85990) is a secondary amino compound (CHEBI:50995) |
| panobinostat (CHEBI:85990) is conjugate base of panobinostat(1+) (CHEBI:85992) |
| Incoming Relation(s) |
| panobinostat(1+) (CHEBI:85992) is conjugate acid of panobinostat (CHEBI:85990) |
| IUPAC Name |
|---|
| (2E)-N-hydroxy-3-[4-({[2-(2-methyl-1H-indol-3-yl)ethyl]amino}methyl)phenyl]prop-2-enamide |
| INN | Source |
|---|---|
| panobinostat | KEGG DRUG |
| Synonyms | Source |
|---|---|
| LBH589 | ChemIDplus |
| LBH 589 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10319 | KEGG DRUG |
| Panobinostat | Wikipedia |
| 4682 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12257756 | Reaxys |
| CAS:404950-80-7 | KEGG DRUG |
| CAS:404950-80-7 | ChemIDplus |
| Citations |
|---|