EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H.C24H30ClN7O4S |
| Net Charge | +1 |
| Average Mass | 549.077 |
| Monoisotopic Mass | 548.18413 |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1.[H+] |
| InChI | InChI=1S/C24H30ClN7O4S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/p+1/t13-,15-,17+/m0/s1 |
| InChIKey | HGVDHZBSSITLCT-JLJPHGGASA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edoxaban(1+) (CHEBI:85976) is a organic cation (CHEBI:25697) |
| edoxaban(1+) (CHEBI:85976) is conjugate acid of edoxaban (CHEBI:85973) |
| Incoming Relation(s) |
| edoxaban tosylate (CHEBI:85975) has part edoxaban(1+) (CHEBI:85976) |
| edoxaban (CHEBI:85973) is conjugate base of edoxaban(1+) (CHEBI:85976) |
| Synonym | Source |
|---|---|
| edoxaban cation | ChEBI |