EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30ClN7O4S.C7H8O3S |
| Net Charge | 0 |
| Average Mass | 720.274 |
| Monoisotopic Mass | 719.19627 |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C24H30ClN7O4S.C7H8O3S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23;1-6-2-4-7(5-3-6)11(8,9)10/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34);2-5H,1H3,(H,8,9,10)/t13-,15-,17+;/m0./s1 |
| InChIKey | ZLFZITWZOYXXAW-QXXZOGQOSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Applications: | anticoagulant An agent that prevents blood clotting. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edoxaban tosylate (CHEBI:85975) has part edoxaban(1+) (CHEBI:85976) |
| edoxaban tosylate (CHEBI:85975) has role anticoagulant (CHEBI:50249) |
| edoxaban tosylate (CHEBI:85975) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| edoxaban tosylate (CHEBI:85975) has role platelet aggregation inhibitor (CHEBI:50427) |
| edoxaban tosylate (CHEBI:85975) is a organosulfonate salt (CHEBI:64382) |
| Incoming Relation(s) |
| edoxaban tosylate hydrate (CHEBI:85974) has part edoxaban tosylate (CHEBI:85975) |
| IUPAC Name |
|---|
| 4-methylbenzene-1-sulfonic acid—N1-(5-chloropyridin-2-yl)-N2-{(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl}ethanediamide (1/1) |
| Synonyms | Source |
|---|---|
| DU 176b | ChemIDplus |
| DU-176b | ChemIDplus |
| edoxaban 4-toluenesulfonate | ChEBI |
| edoxaban p-toluenesulfonate | ChEBI |
| edoxaban monotosylate | ChEBI |
| Edoxaban tosilate | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Edoxaban | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11410837 | Reaxys |
| CAS:480449-71-6 | ChemIDplus |
| Citations |
|---|