EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H30ClN7O4S |
| Net Charge | 0 |
| Average Mass | 548.069 |
| Monoisotopic Mass | 547.17685 |
| SMILES | CN1CCc2nc(C(=O)N[C@@H]3C[C@@H](C(=O)N(C)C)CC[C@@H]3NC(=O)C(=O)Nc3ccc(Cl)cn3)sc2C1 |
| InChI | InChI=1S/C24H30ClN7O4S/c1-31(2)24(36)13-4-6-15(27-20(33)21(34)30-19-7-5-14(25)11-26-19)17(10-13)28-22(35)23-29-16-8-9-32(3)12-18(16)37-23/h5,7,11,13,15,17H,4,6,8-10,12H2,1-3H3,(H,27,33)(H,28,35)(H,26,30,34)/t13-,15-,17+/m0/s1 |
| InChIKey | HGVDHZBSSITLCT-JLJPHGGASA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 3.4.21.6 (coagulation factor Xa) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of coagulation factor Xa (EC 3.4.21.6). |
| Applications: | anti-arrhythmia drug A drug used for the treatment or prevention of cardiac arrhythmias. Anti-arrhythmia drugs may affect the polarisation-repolarisation phase of the action potential, its excitability or refractoriness, or impulse conduction or membrane responsiveness within cardiac fibres. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anticoagulant An agent that prevents blood clotting. hepatoprotective agent Any compound that is able to prevent damage to the liver. platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| edoxaban (CHEBI:85973) has role anti-arrhythmia drug (CHEBI:38070) |
| edoxaban (CHEBI:85973) has role anticoagulant (CHEBI:50249) |
| edoxaban (CHEBI:85973) has role antiviral agent (CHEBI:22587) |
| edoxaban (CHEBI:85973) has role cardiovascular drug (CHEBI:35554) |
| edoxaban (CHEBI:85973) has role EC 3.4.21.6 (coagulation factor Xa) inhibitor (CHEBI:68581) |
| edoxaban (CHEBI:85973) has role hepatoprotective agent (CHEBI:62868) |
| edoxaban (CHEBI:85973) has role platelet aggregation inhibitor (CHEBI:50427) |
| edoxaban (CHEBI:85973) is a chloropyridine (CHEBI:39173) |
| edoxaban (CHEBI:85973) is a monocarboxylic acid amide (CHEBI:29347) |
| edoxaban (CHEBI:85973) is a tertiary amino compound (CHEBI:50996) |
| edoxaban (CHEBI:85973) is a thiazolopyridine (CHEBI:46956) |
| edoxaban (CHEBI:85973) is conjugate base of edoxaban(1+) (CHEBI:85976) |
| Incoming Relation(s) |
| edoxaban(1+) (CHEBI:85976) is conjugate acid of edoxaban (CHEBI:85973) |
| IUPAC Name |
|---|
| N1-(5-chloropyridin-2-yl)-N2-{(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(5-methyl-4,5,6,7-tetrahydro[1,3]thiazolo[5,4-c]pyridine-2-carbonyl)amino]cyclohexyl}ethanediamide |
| INN | Source |
|---|---|
| edoxaban | KEGG DRUG |
| Synonym | Source |
|---|---|
| DU-176 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11407476 | Reaxys |
| CAS:480449-70-5 | ChemIDplus |
| CAS:480449-70-5 | KEGG DRUG |
| Citations |
|---|