EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22N.Cl |
| Net Charge | 0 |
| Average Mass | 299.845 |
| Monoisotopic Mass | 299.14408 |
| SMILES | [Cl-].[H][N+]([H])(C)CCCC1c2ccccc2C=Cc2ccccc21 |
| InChI | InChI=1S/C19H21N.ClH/c1-20-14-6-11-19-17-9-4-2-7-15(17)12-13-16-8-3-5-10-18(16)19;/h2-5,7-10,12-13,19-20H,6,11,14H2,1H3;1H |
| InChIKey | OGQDIIKRQRZXJH-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| protriptyline hydrochloride (CHEBI:8598) has part protriptyline (CHEBI:8597) |
| protriptyline hydrochloride (CHEBI:8598) has role antidepressant (CHEBI:35469) |
| protriptyline hydrochloride (CHEBI:8598) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 3-(5H-dibenzo[a,d][7]annulen-5-yl)-N-methylpropan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| Protriptyline hydrochloride | ChemIDplus |
| Concordin | ChemIDplus |
| Triptil | ChemIDplus |
| MK-240 | ChemIDplus |