EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | [H]C(=O)C(C)=C(O)C([H])=C(O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c1-4(3-8)5(9)2-6(10)7(11)12/h2-3,9-10H,1H3,(H,11,12) |
| InChIKey | YKJSDORVRVLNNE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia sp. (ncbitaxon:36773) | - | PubMed (9922262) | Strain: DNT |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) has role bacterial xenobiotic metabolite (CHEBI:76976) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) is a dihydroxy monocarboxylic acid (CHEBI:35972) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) is a muconic semialdehyde (CHEBI:38436) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) is conjugate acid of 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoate (CHEBI:85578) |
| Incoming Relation(s) |
| cis,cis-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:81669) is a 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) |
| trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:169981) is a 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) |
| 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoate (CHEBI:85578) is conjugate base of 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) |
| IUPAC Name |
|---|
| 2,4-dihydroxy-5-methyl-6-oxohexa-2,4-dienoic acid |
| Citations |
|---|