EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H8O5 |
| Net Charge | 0 |
| Average Mass | 172.136 |
| Monoisotopic Mass | 172.03717 |
| SMILES | [H]C(=O)/C(C)=C(O)\C=C(\O)C(=O)O |
| InChI | InChI=1S/C7H8O5/c1-4(3-8)5(9)2-6(10)7(11)12/h2-3,9-10H,1H3,(H,11,12)/b5-4+,6-2+ |
| InChIKey | YKJSDORVRVLNNE-JYZMYEGWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial xenobiotic metabolite Any bacterial metabolite produced by metabolism of a xenobiotic compound in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:169981) is a 2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:85913) |
| trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:169981) is conjugate acid of trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoate (CHEBI:169982) |
| Incoming Relation(s) |
| trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoate (CHEBI:169982) is conjugate base of trans,trans-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid (CHEBI:169981) |
| IUPAC Name |
|---|
| (2E,4E)-2,4-dihydroxy-5-methyl-6-oxohexa-2,4-dienoic acid |
| Synonym | Source |
|---|---|
| (E,E)-2,4-dihydroxy-5-methyl-6-oxo-2,4-hexadienoic acid | ChEBI |